C10H18N4 — CID 130569459
2,2-dimethyl-1-(1H-pyrazol-4-ylmethyl)piperazine (PubChem CID 130569459) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,2-dimethyl-1-(1H-pyrazol-4-ylmethyl)piperazine.
| Compound Name | 2,2-dimethyl-1-(1H-pyrazol-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 130569459 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2,2-dimethyl-1-(1H-pyrazol-4-ylmethyl)piperazine |
| SMILES | CC1(C)CNCCN1Cc1cn[nH]c1 |
| InChI | InChI=1S/C10H18N4/c1-10(2)8-11-3-4-14(10)7-9-5-12-13-6-9/h5-6,11H,3-4,7-8H2,1-2H3,(H,12,13) |
| InChIKey | MZMHNVDCUMPRNN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |