C14H21ClN2 — CID 82245127
1-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,4-diazepane (PubChem CID 82245127) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,4-diazepane.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 82245127 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2,2-dimethyl-1,4-diazepane |
| SMILES | CC1(C)CNCCCN1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2/c1-14(2)11-16-8-3-9-17(14)10-12-4-6-13(15)7-5-12/h4-7,16H,3,8-11H2,1-2H3 |
| InChIKey | TUUYMEOFWQGLQL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |