C13H17BrN2O2 — CID 65361687
1-[(5-bromo-2-methoxyphenyl)methyl]-1,4-diazepan-2-one (PubChem CID 65361687) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl]-1,4-diazepan-2-one.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65361687 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-1,4-diazepan-2-one |
| SMILES | COc1ccc(Br)cc1CN1CCCNCC1=O |
| InChI | InChI=1S/C13H17BrN2O2/c1-18-12-4-3-11(14)7-10(12)9-16-6-2-5-15-8-13(16)17/h3-4,7,15H,2,5-6,8-9H2,1H3 |
| InChIKey | VDARIHOKERMNBN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |