C15H18N2O3 — CID 107274194
3-[2-(3,6-dihydro-2H-pyridine-1-carbonylamino)phenyl]propanoic acid (PubChem CID 107274194) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[2-(3,6-dihydro-2H-pyridine-1-carbonylamino)phenyl]propanoic acid.
| Compound Name | 3-[2-(3,6-dihydro-2H-pyridine-1-carbonylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 107274194 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[2-(3,6-dihydro-2H-pyridine-1-carbonylamino)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1NC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C15H18N2O3/c18-14(19)9-8-12-6-2-3-7-13(12)16-15(20)17-10-4-1-5-11-17/h1-4,6-7H,5,8-11H2,(H,16,20)(H,18,19) |
| InChIKey | YTBKJBFUWWMBDI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|