C22H19FN4OS — CID 30858199
(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylsulfanyl-3-phenylimidazol-4-yl)methanone (PubChem CID 30858199) has the molecular formula C22H19FN4OS and a molecular weight of 406.49 g/mol. Its IUPAC name is (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylsulfanyl-3-phenylimidazol-4-yl)methanone.
| Compound Name | (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylsulfanyl-3-phenylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 30858199 |
| Molecular Formula | C22H19FN4OS |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methylsulfanyl-3-phenylimidazol-4-yl)methanone |
| SMILES | CSc1ncc(C(=O)N2CCc3[nH]c4ccc(F)cc4c3C2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H19FN4OS/c1-29-22-24-12-20(27(22)15-5-3-2-4-6-15)21(28)26-10-9-19-17(13-26)16-11-14(23)7-8-18(16)25-19/h2-8,11-12,25H,9-10,13H2,1H3 |
| InChIKey | HETVGTDDMVSBTR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|