C21H21N3O — CID 159066402
methane;7-methoxy-3-phenyl-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole (PubChem CID 159066402) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is methane;7-methoxy-3-phenyl-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole.
| Compound Name | methane;7-methoxy-3-phenyl-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
|---|---|
| PubChem CID | 159066402 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | methane;7-methoxy-3-phenyl-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
| SMILES | C.COc1ccc2[nH]c3c(c2c1)CCc1c(-c2ccccc2)n[nH]c1-3 |
| InChI | InChI=1S/C20H17N3O.CH4/c1-24-13-7-10-17-16(11-13)14-8-9-15-18(12-5-3-2-4-6-12)22-23-20(15)19(14)21-17;/h2-7,10-11,21H,8-9H2,1H3,(H,22,23);1H4 |
| InChIKey | JZCJDALXXLOTCI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|