C12H7N3O2 — CID 110272546
6-methoxy-4-oxo-1H-quinoline-2,3-dicarbonitrile (PubChem CID 110272546) has the molecular formula C12H7N3O2 and a molecular weight of 225.21 g/mol. Its IUPAC name is 6-methoxy-4-oxo-1H-quinoline-2,3-dicarbonitrile.
| Compound Name | 6-methoxy-4-oxo-1H-quinoline-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 110272546 |
| Molecular Formula | C12H7N3O2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 6-methoxy-4-oxo-1H-quinoline-2,3-dicarbonitrile |
| SMILES | COc1ccc2[nH]c(C#N)c(C#N)c(=O)c2c1 |
| InChI | InChI=1S/C12H7N3O2/c1-17-7-2-3-10-8(4-7)12(16)9(5-13)11(6-14)15-10/h2-4H,1H3,(H,15,16) |
| InChIKey | SQCTZMUWFQDLSA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |