C23H18N2O3 — CID 139796239
5-ethyl-2-methoxy-12H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 139796239) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-ethyl-2-methoxy-12H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5-ethyl-2-methoxy-12H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139796239 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-ethyl-2-methoxy-12H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCn1c2ccc(OC)cc2c(=O)c2cc3[nH]c4ccccc4c(=O)c3cc21 |
| InChI | InChI=1S/C23H18N2O3/c1-3-25-20-9-8-13(28-2)10-16(20)23(27)17-11-19-15(12-21(17)25)22(26)14-6-4-5-7-18(14)24-19/h4-12H,3H2,1-2H3,(H,24,26) |
| InChIKey | KYFKJBZMMVOFHA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|