C29H22N2O5 — CID 139791356
2,4,9-trimethoxy-12-phenyl-5H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 139791356) has the molecular formula C29H22N2O5 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2,4,9-trimethoxy-12-phenyl-5H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,4,9-trimethoxy-12-phenyl-5H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139791356 |
| Molecular Formula | C29H22N2O5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2,4,9-trimethoxy-12-phenyl-5H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | COc1cc(OC)c2[nH]c3cc4c(=O)c5cc(OC)ccc5n(-c5ccccc5)c4cc3c(=O)c2c1 |
| InChI | InChI=1S/C29H22N2O5/c1-34-17-9-10-24-20(11-17)29(33)21-14-23-19(15-25(21)31(24)16-7-5-4-6-8-16)28(32)22-12-18(35-2)13-26(36-3)27(22)30-23/h4-15H,1-3H3,(H,30,32) |
| InChIKey | GZGATMFXJFWDKL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|