C48H36N2O6 — CID 58669175
4,11-dimethoxy-5,12-bis(4-methoxyphenyl)-1,8-diphenylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 58669175) has the molecular formula C48H36N2O6 and a molecular weight of 736.82 g/mol. Its IUPAC name is 4,11-dimethoxy-5,12-bis(4-methoxyphenyl)-1,8-diphenylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 4,11-dimethoxy-5,12-bis(4-methoxyphenyl)-1,8-diphenylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 58669175 |
| Molecular Formula | C48H36N2O6 |
| Molecular Weight | 736.82 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | 4,11-dimethoxy-5,12-bis(4-methoxyphenyl)-1,8-diphenylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | COc1ccc(-n2c3cc4c(=O)c5c(-c6ccccc6)ccc(OC)c5n(-c5ccc(OC)cc5)c4cc3c(=O)c3c(-c4ccccc4)ccc(OC)c32)cc1 |
| InChI | InChI=1S/C48H36N2O6/c1-53-33-19-15-31(16-20-33)49-39-27-38-40(28-37(39)47(51)43-35(29-11-7-5-8-12-29)23-25-41(55-3)45(43)49)50(32-17-21-34(54-2)22-18-32)46-42(56-4)26-24-36(44(46)48(38)52)30-13-9-6-10-14-30/h5-28H,1-4H3 |
| InChIKey | CKAOLZSQBZQZBG-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|