C26H24N2O2 — CID 139796151
5-butyl-2-ethyl-12H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 139796151) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-butyl-2-ethyl-12H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5-butyl-2-ethyl-12H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139796151 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 5-butyl-2-ethyl-12H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCCCn1c2ccc(CC)cc2c(=O)c2cc3[nH]c4ccccc4c(=O)c3cc21 |
| InChI | InChI=1S/C26H24N2O2/c1-3-5-12-28-23-11-10-16(4-2)13-19(23)26(30)20-14-22-18(15-24(20)28)25(29)17-8-6-7-9-21(17)27-22/h6-11,13-15H,3-5,12H2,1-2H3,(H,27,29) |
| InChIKey | BEIXUDJUUHRIOT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|