C27H21N3O4 — CID 143390862
6-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,3-bis(ethenyl)-1H-pyrido[2,3-b]acridine-4,11-dione (PubChem CID 143390862) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 6-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,3-bis(ethenyl)-1H-pyrido[2,3-b]acridine-4,11-dione.
| Compound Name | 6-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,3-bis(ethenyl)-1H-pyrido[2,3-b]acridine-4,11-dione |
|---|---|
| PubChem CID | 143390862 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 6-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,3-bis(ethenyl)-1H-pyrido[2,3-b]acridine-4,11-dione |
| SMILES | C=Cc1[nH]c2cc3c(=O)c4ccccc4n(CCCN4C(=O)C=CC4=O)c3cc2c(=O)c1C=C |
| InChI | InChI=1S/C27H21N3O4/c1-3-16-20(4-2)28-21-14-19-23(15-18(21)26(16)33)29(22-9-6-5-8-17(22)27(19)34)12-7-13-30-24(31)10-11-25(30)32/h3-6,8-11,14-15H,1-2,7,12-13H2,(H,28,33) |
| InChIKey | TYOWJMUDORMDQR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|