C50H40N2O4 — CID 139788407
4,11-bis[4-(2-phenylpropan-2-yl)phenoxy]-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 139788407) has the molecular formula C50H40N2O4 and a molecular weight of 732.88 g/mol. Its IUPAC name is 4,11-bis[4-(2-phenylpropan-2-yl)phenoxy]-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 4,11-bis[4-(2-phenylpropan-2-yl)phenoxy]-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139788407 |
| Molecular Formula | C50H40N2O4 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | 4,11-bis[4-(2-phenylpropan-2-yl)phenoxy]-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2cccc3c(=O)c4cc5[nH]c6c(Oc7ccc(C(C)(C)c8ccccc8)cc7)cccc6c(=O)c5cc4[nH]c23)cc1 |
| InChI | InChI=1S/C50H40N2O4/c1-49(2,31-13-7-5-8-14-31)33-21-25-35(26-22-33)55-43-19-11-17-37-45(43)51-41-29-40-42(30-39(41)47(37)53)52-46-38(48(40)54)18-12-20-44(46)56-36-27-23-34(24-28-36)50(3,4)32-15-9-6-10-16-32/h5-30H,1-4H3,(H,51,53)(H,52,54) |
| InChIKey | PKMSHSRGYKPRDF-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|