C35H28O6 — CID 123422321
6-[4-[2-[4-(5,8-dihydroxynaphthalen-2-yl)oxyphenyl]propan-2-yl]phenoxy]naphthalene-1,4-diol (PubChem CID 123422321) has the molecular formula C35H28O6 and a molecular weight of 544.60 g/mol. Its IUPAC name is 6-[4-[2-[4-(5,8-dihydroxynaphthalen-2-yl)oxyphenyl]propan-2-yl]phenoxy]naphthalene-1,4-diol.
| Compound Name | 6-[4-[2-[4-(5,8-dihydroxynaphthalen-2-yl)oxyphenyl]propan-2-yl]phenoxy]naphthalene-1,4-diol |
|---|---|
| PubChem CID | 123422321 |
| Molecular Formula | C35H28O6 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 6-[4-[2-[4-(5,8-dihydroxynaphthalen-2-yl)oxyphenyl]propan-2-yl]phenoxy]naphthalene-1,4-diol |
| SMILES | CC(C)(c1ccc(Oc2ccc3c(O)ccc(O)c3c2)cc1)c1ccc(Oc2ccc3c(O)ccc(O)c3c2)cc1 |
| InChI | InChI=1S/C35H28O6/c1-35(2,21-3-7-23(8-4-21)40-25-11-13-27-29(19-25)33(38)17-15-31(27)36)22-5-9-24(10-6-22)41-26-12-14-28-30(20-26)34(39)18-16-32(28)37/h3-20,36-39H,1-2H3 |
| InChIKey | XQKZESXNCFQOFF-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|