C17H14N2O2 — CID 12689259
7-tert-butyl-5-oxochromeno[2,3-b]pyridine-3-carbonitrile (PubChem CID 12689259) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 7-tert-butyl-5-oxochromeno[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 7-tert-butyl-5-oxochromeno[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12689259 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 7-tert-butyl-5-oxochromeno[2,3-b]pyridine-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc2oc3ncc(C#N)cc3c(=O)c2c1 |
| InChI | InChI=1S/C17H14N2O2/c1-17(2,3)11-4-5-14-12(7-11)15(20)13-6-10(8-18)9-19-16(13)21-14/h4-7,9H,1-3H3 |
| InChIKey | JWXMMTIMHZSRFT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|