C40H33NO4 — CID 164765359
1-(3,6-ditert-butylcarbazol-9-yl)chromeno[3,2-b]xanthene-12,14-dione (PubChem CID 164765359) has the molecular formula C40H33NO4 and a molecular weight of 591.71 g/mol. Its IUPAC name is 1-(3,6-ditert-butylcarbazol-9-yl)chromeno[3,2-b]xanthene-12,14-dione.
| Compound Name | 1-(3,6-ditert-butylcarbazol-9-yl)chromeno[3,2-b]xanthene-12,14-dione |
|---|---|
| PubChem CID | 164765359 |
| Molecular Formula | C40H33NO4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 1-(3,6-ditert-butylcarbazol-9-yl)chromeno[3,2-b]xanthene-12,14-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccc2oc3cc4oc5ccccc5c(=O)c4cc3c(=O)c12 |
| InChI | InChI=1S/C40H33NO4/c1-39(2,3)22-14-16-29-25(18-22)26-19-23(40(4,5)6)15-17-30(26)41(29)31-11-9-13-33-36(31)38(43)28-20-27-34(21-35(28)45-33)44-32-12-8-7-10-24(32)37(27)42/h7-21H,1-6H3 |
| InChIKey | WGIZZFUIOPARKJ-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 65.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|