C18H21O4- — CID 6919022
6,8-ditert-butyl-4-oxochromene-2-carboxylate (PubChem CID 6919022) has the molecular formula C18H21O4- and a molecular weight of 301.36 g/mol. Its IUPAC name is 6,8-ditert-butyl-4-oxochromene-2-carboxylate.
| Compound Name | 6,8-ditert-butyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 6919022 |
| Molecular Formula | C18H21O4- |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 6,8-ditert-butyl-4-oxochromene-2-carboxylate |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(C(=O)[O-])cc(=O)c2c1 |
| InChI | InChI=1S/C18H22O4/c1-17(2,3)10-7-11-13(19)9-14(16(20)21)22-15(11)12(8-10)18(4,5)6/h7-9H,1-6H3,(H,20,21)/p-1 |
| InChIKey | CJTURQGHQPDNDA-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |