C29H32N6O9 — CID 101097043
1,3-bis[6-tert-butyl-2-[(hydroxyamino)carbamoyl]-4-oxochromen-8-yl]urea (PubChem CID 101097043) has the molecular formula C29H32N6O9 and a molecular weight of 608.61 g/mol. Its IUPAC name is 1,3-bis[6-tert-butyl-2-[(hydroxyamino)carbamoyl]-4-oxochromen-8-yl]urea.
| Compound Name | 1,3-bis[6-tert-butyl-2-[(hydroxyamino)carbamoyl]-4-oxochromen-8-yl]urea |
|---|---|
| PubChem CID | 101097043 |
| Molecular Formula | C29H32N6O9 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 1,3-bis[6-tert-butyl-2-[(hydroxyamino)carbamoyl]-4-oxochromen-8-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cc(C(C)(C)C)cc3c(=O)cc(C(=O)NNO)oc23)c2oc(C(=O)NNO)cc(=O)c2c1 |
| InChI | InChI=1S/C29H32N6O9/c1-28(2,3)13-7-15-19(36)11-21(25(38)32-34-41)43-23(15)17(9-13)30-27(40)31-18-10-14(29(4,5)6)8-16-20(37)12-22(44-24(16)18)26(39)33-35-42/h7-12,34-35,41-42H,1-6H3,(H,32,38)(H,33,39)(H2,30,31,40) |
| InChIKey | FCXNJJWGXFWGBO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 224.27 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|