C17H12BrNO3 — CID 19118994
N-(4-bromophenyl)-8-methyl-4-oxochromene-2-carboxamide (PubChem CID 19118994) has the molecular formula C17H12BrNO3 and a molecular weight of 358.19 g/mol. Its IUPAC name is N-(4-bromophenyl)-8-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-8-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 19118994 |
| Molecular Formula | C17H12BrNO3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(4-bromophenyl)-8-methyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Br)cc3)oc12 |
| InChI | InChI=1S/C17H12BrNO3/c1-10-3-2-4-13-14(20)9-15(22-16(10)13)17(21)19-12-7-5-11(18)6-8-12/h2-9H,1H3,(H,19,21) |
| InChIKey | LMBTWFUUHLRYAQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |