C27H41N3O4 — CID 15291179
N-butyl-6-tert-butyl-4-oxo-8-(2,4,4-trimethylpentan-2-ylcarbamoylamino)chromene-2-carboxamide (PubChem CID 15291179) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is N-butyl-6-tert-butyl-4-oxo-8-(2,4,4-trimethylpentan-2-ylcarbamoylamino)chromene-2-carboxamide.
| Compound Name | N-butyl-6-tert-butyl-4-oxo-8-(2,4,4-trimethylpentan-2-ylcarbamoylamino)chromene-2-carboxamide |
|---|---|
| PubChem CID | 15291179 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | N-butyl-6-tert-butyl-4-oxo-8-(2,4,4-trimethylpentan-2-ylcarbamoylamino)chromene-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(=O)c2cc(C(C)(C)C)cc(NC(=O)NC(C)(C)CC(C)(C)C)c2o1 |
| InChI | InChI=1S/C27H41N3O4/c1-10-11-12-28-23(32)21-15-20(31)18-13-17(26(5,6)7)14-19(22(18)34-21)29-24(33)30-27(8,9)16-25(2,3)4/h13-15H,10-12,16H2,1-9H3,(H,28,32)(H2,29,30,33) |
| InChIKey | XNTQOARRWGAARD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|