C29H32N6O7 — CID 101097039
1,3-bis[6-tert-butyl-2-(hydrazinecarbonyl)-4-oxochromen-8-yl]urea (PubChem CID 101097039) has the molecular formula C29H32N6O7 and a molecular weight of 576.61 g/mol. Its IUPAC name is 1,3-bis[6-tert-butyl-2-(hydrazinecarbonyl)-4-oxochromen-8-yl]urea.
| Compound Name | 1,3-bis[6-tert-butyl-2-(hydrazinecarbonyl)-4-oxochromen-8-yl]urea |
|---|---|
| PubChem CID | 101097039 |
| Molecular Formula | C29H32N6O7 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 1,3-bis[6-tert-butyl-2-(hydrazinecarbonyl)-4-oxochromen-8-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cc(C(C)(C)C)cc3c(=O)cc(C(=O)NN)oc23)c2oc(C(=O)NN)cc(=O)c2c1 |
| InChI | InChI=1S/C29H32N6O7/c1-28(2,3)13-7-15-19(36)11-21(25(38)34-30)41-23(15)17(9-13)32-27(40)33-18-10-14(29(4,5)6)8-16-20(37)12-22(26(39)35-31)42-24(16)18/h7-12H,30-31H2,1-6H3,(H,34,38)(H,35,39)(H2,32,33,40) |
| InChIKey | DDKCBWLDMYYADY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 211.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|