C14H16NO7P — CID 10246671
8-(diethoxyphosphorylamino)-4-oxochromene-2-carboxylic acid (PubChem CID 10246671) has the molecular formula C14H16NO7P and a molecular weight of 341.26 g/mol. Its IUPAC name is 8-(diethoxyphosphorylamino)-4-oxochromene-2-carboxylic acid.
| Compound Name | 8-(diethoxyphosphorylamino)-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10246671 |
| Molecular Formula | C14H16NO7P |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 8-(diethoxyphosphorylamino)-4-oxochromene-2-carboxylic acid |
| SMILES | CCOP(=O)(Nc1cccc2c(=O)cc(C(=O)O)oc12)OCC |
| InChI | InChI=1S/C14H16NO7P/c1-3-20-23(19,21-4-2)15-10-7-5-6-9-11(16)8-12(14(17)18)22-13(9)10/h5-8H,3-4H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | FSHNWQZHPILLHX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|