C21H13NO5 — CID 71734946
8-(naphthalene-2-carbonylamino)-4-oxochromene-2-carboxylic acid (PubChem CID 71734946) has the molecular formula C21H13NO5 and a molecular weight of 359.34 g/mol. Its IUPAC name is 8-(naphthalene-2-carbonylamino)-4-oxochromene-2-carboxylic acid.
| Compound Name | 8-(naphthalene-2-carbonylamino)-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 71734946 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 8-(naphthalene-2-carbonylamino)-4-oxochromene-2-carboxylic acid |
| SMILES | O=C(Nc1cccc2c(=O)cc(C(=O)O)oc12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H13NO5/c23-17-11-18(21(25)26)27-19-15(17)6-3-7-16(19)22-20(24)14-9-8-12-4-1-2-5-13(12)10-14/h1-11H,(H,22,24)(H,25,26) |
| InChIKey | DQPJQHLZZHUOLW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |