C18H15NO7S — CID 139832919
ethyl 8-[(4-hydroxyphenyl)sulfonylamino]-4-oxochromene-2-carboxylate (PubChem CID 139832919) has the molecular formula C18H15NO7S and a molecular weight of 389.39 g/mol. Its IUPAC name is ethyl 8-[(4-hydroxyphenyl)sulfonylamino]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 8-[(4-hydroxyphenyl)sulfonylamino]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 139832919 |
| Molecular Formula | C18H15NO7S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | ethyl 8-[(4-hydroxyphenyl)sulfonylamino]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2cccc(NS(=O)(=O)c3ccc(O)cc3)c2o1 |
| InChI | InChI=1S/C18H15NO7S/c1-2-25-18(22)16-10-15(21)13-4-3-5-14(17(13)26-16)19-27(23,24)12-8-6-11(20)7-9-12/h3-10,19-20H,2H2,1H3 |
| InChIKey | OVGYRJWQMQDXBG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |