C18H14O7 — CID 23347467
7-acetyl-5-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid (PubChem CID 23347467) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is 7-acetyl-5-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid.
| Compound Name | 7-acetyl-5-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid |
|---|---|
| PubChem CID | 23347467 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 7-acetyl-5-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid |
| SMILES | CC(=O)c1cc(OCCO)c2oc3ccc(C(=O)O)cc3c(=O)c2c1 |
| InChI | InChI=1S/C18H14O7/c1-9(20)11-7-13-16(21)12-6-10(18(22)23)2-3-14(12)25-17(13)15(8-11)24-5-4-19/h2-3,6-8,19H,4-5H2,1H3,(H,22,23) |
| InChIKey | MUQGWKLYLPPUEG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|