C17H12O7 — CID 162868360
4,9-dihydroxy-3,8-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 162868360) has the molecular formula C17H12O7 and a molecular weight of 328.28 g/mol. Its IUPAC name is 4,9-dihydroxy-3,8-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 4,9-dihydroxy-3,8-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 162868360 |
| Molecular Formula | C17H12O7 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4,9-dihydroxy-3,8-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | COc1cc2c(cc1O)oc1c3ccc(OC)c(O)c3oc(=O)c21 |
| InChI | InChI=1S/C17H12O7/c1-21-10-4-3-7-15-13(17(20)24-16(7)14(10)19)8-5-12(22-2)9(18)6-11(8)23-15/h3-6,18-19H,1-2H3 |
| InChIKey | LWHXUIMIAFTSKX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|