C27H32O8 — CID 11785001
1,3-bis(methoxymethoxy)-5,6-bis(2-methylbut-3-en-2-yloxy)xanthen-9-one (PubChem CID 11785001) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is 1,3-bis(methoxymethoxy)-5,6-bis(2-methylbut-3-en-2-yloxy)xanthen-9-one.
| Compound Name | 1,3-bis(methoxymethoxy)-5,6-bis(2-methylbut-3-en-2-yloxy)xanthen-9-one |
|---|---|
| PubChem CID | 11785001 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1,3-bis(methoxymethoxy)-5,6-bis(2-methylbut-3-en-2-yloxy)xanthen-9-one |
| SMILES | C=CC(C)(C)Oc1ccc2c(=O)c3c(OCOC)cc(OCOC)cc3oc2c1OC(C)(C)C=C |
| InChI | InChI=1S/C27H32O8/c1-9-26(3,4)34-19-12-11-18-23(28)22-20(32-16-30-8)13-17(31-15-29-7)14-21(22)33-24(18)25(19)35-27(5,6)10-2/h9-14H,1-2,15-16H2,3-8H3 |
| InChIKey | SJGUVUCNCMJHBJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|