C33H41NO6 — CID 71546030
5-[(E)-4-[di(propan-2-yl)amino]but-2-enoxy]-1-hydroxy-6-(2-methylbut-3-en-2-yloxy)-3-(2-methylbut-3-yn-2-yloxy)xanthen-9-one (PubChem CID 71546030) has the molecular formula C33H41NO6 and a molecular weight of 547.69 g/mol. Its IUPAC name is 5-[(E)-4-[di(propan-2-yl)amino]but-2-enoxy]-1-hydroxy-6-(2-methylbut-3-en-2-yloxy)-3-(2-methylbut-3-yn-2-yloxy)xanthen-9-one.
| Compound Name | 5-[(E)-4-[di(propan-2-yl)amino]but-2-enoxy]-1-hydroxy-6-(2-methylbut-3-en-2-yloxy)-3-(2-methylbut-3-yn-2-yloxy)xanthen-9-one |
|---|---|
| PubChem CID | 71546030 |
| Molecular Formula | C33H41NO6 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 5-[(E)-4-[di(propan-2-yl)amino]but-2-enoxy]-1-hydroxy-6-(2-methylbut-3-en-2-yloxy)-3-(2-methylbut-3-yn-2-yloxy)xanthen-9-one |
| SMILES | C#CC(C)(C)Oc1cc(O)c2c(=O)c3ccc(OC(C)(C)C=C)c(OC/C=C/CN(C(C)C)C(C)C)c3oc2c1 |
| InChI | InChI=1S/C33H41NO6/c1-11-32(7,8)39-23-19-25(35)28-27(20-23)38-30-24(29(28)36)15-16-26(40-33(9,10)12-2)31(30)37-18-14-13-17-34(21(3)4)22(5)6/h1,12-16,19-22,35H,2,17-18H2,3-10H3/b14-13+ |
| InChIKey | UKXGALWGXGHTAX-BUHFOSPRSA-N |
| XLogP | 6.84 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|