C14H14O3 — CID 12900448
7-hydroxy-4,5-dimethyl-8-prop-2-enylchromen-2-one (PubChem CID 12900448) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 7-hydroxy-4,5-dimethyl-8-prop-2-enylchromen-2-one.
| Compound Name | 7-hydroxy-4,5-dimethyl-8-prop-2-enylchromen-2-one |
|---|---|
| PubChem CID | 12900448 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 7-hydroxy-4,5-dimethyl-8-prop-2-enylchromen-2-one |
| SMILES | C=CCc1c(O)cc(C)c2c(C)cc(=O)oc12 |
| InChI | InChI=1S/C14H14O3/c1-4-5-10-11(15)6-8(2)13-9(3)7-12(16)17-14(10)13/h4,6-7,15H,1,5H2,2-3H3 |
| InChIKey | MPFVJFZXBSSXOD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|