C19H18O7 — CID 88718378
ethyl 4-(7-hydroxy-4-methyl-2-oxo-8-prop-2-enylchromen-6-yl)-2,4-dioxobutanoate (PubChem CID 88718378) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is ethyl 4-(7-hydroxy-4-methyl-2-oxo-8-prop-2-enylchromen-6-yl)-2,4-dioxobutanoate.
| Compound Name | ethyl 4-(7-hydroxy-4-methyl-2-oxo-8-prop-2-enylchromen-6-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 88718378 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl 4-(7-hydroxy-4-methyl-2-oxo-8-prop-2-enylchromen-6-yl)-2,4-dioxobutanoate |
| SMILES | C=CCc1c(O)c(C(=O)CC(=O)C(=O)OCC)cc2c(C)cc(=O)oc12 |
| InChI | InChI=1S/C19H18O7/c1-4-6-11-17(23)13(14(20)9-15(21)19(24)25-5-2)8-12-10(3)7-16(22)26-18(11)12/h4,7-8,23H,1,5-6,9H2,2-3H3 |
| InChIKey | POGSQMYVGJPJIL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|