C13H10FNO6 — CID 155686027
ethyl 4-(4-fluoro-2-oxo-3H-1,3-benzoxazol-7-yl)-2,4-dioxobutanoate (PubChem CID 155686027) has the molecular formula C13H10FNO6 and a molecular weight of 295.22 g/mol. Its IUPAC name is ethyl 4-(4-fluoro-2-oxo-3H-1,3-benzoxazol-7-yl)-2,4-dioxobutanoate.
| Compound Name | ethyl 4-(4-fluoro-2-oxo-3H-1,3-benzoxazol-7-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 155686027 |
| Molecular Formula | C13H10FNO6 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | ethyl 4-(4-fluoro-2-oxo-3H-1,3-benzoxazol-7-yl)-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(F)c2[nH]c(=O)oc12 |
| InChI | InChI=1S/C13H10FNO6/c1-2-20-12(18)9(17)5-8(16)6-3-4-7(14)10-11(6)21-13(19)15-10/h3-4H,2,5H2,1H3,(H,15,19) |
| InChIKey | NKVAPVIDLYJXCS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|