C15H15NO5 — CID 59776448
ethyl N-[4-methyl-2-oxo-8-(2-oxoethyl)chromen-7-yl]carbamate (PubChem CID 59776448) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is ethyl N-[4-methyl-2-oxo-8-(2-oxoethyl)chromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-2-oxo-8-(2-oxoethyl)chromen-7-yl]carbamate |
|---|---|
| PubChem CID | 59776448 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl N-[4-methyl-2-oxo-8-(2-oxoethyl)chromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(C)cc(=O)oc2c1CC=O |
| InChI | InChI=1S/C15H15NO5/c1-3-20-15(19)16-12-5-4-10-9(2)8-13(18)21-14(10)11(12)6-7-17/h4-5,7-8H,3,6H2,1-2H3,(H,16,19) |
| InChIKey | BNCQMYCTZOFTEE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|