C17H14F3NO5 — CID 86587734
ethyl 4-oxo-8-prop-2-enyl-7-[(2,2,2-trifluoroacetyl)amino]chromene-2-carboxylate (PubChem CID 86587734) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is ethyl 4-oxo-8-prop-2-enyl-7-[(2,2,2-trifluoroacetyl)amino]chromene-2-carboxylate.
| Compound Name | ethyl 4-oxo-8-prop-2-enyl-7-[(2,2,2-trifluoroacetyl)amino]chromene-2-carboxylate |
|---|---|
| PubChem CID | 86587734 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | ethyl 4-oxo-8-prop-2-enyl-7-[(2,2,2-trifluoroacetyl)amino]chromene-2-carboxylate |
| SMILES | C=CCc1c(NC(=O)C(F)(F)F)ccc2c(=O)cc(C(=O)OCC)oc12 |
| InChI | InChI=1S/C17H14F3NO5/c1-3-5-9-11(21-16(24)17(18,19)20)7-6-10-12(22)8-13(26-14(9)10)15(23)25-4-2/h3,6-8H,1,4-5H2,2H3,(H,21,24) |
| InChIKey | QTYBZGVHQYCITL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|