C13H12O3S — CID 137292703
6,7-dihydroxy-4-methyl-8-prop-2-enylchromene-2-thione (PubChem CID 137292703) has the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. Its IUPAC name is 6,7-dihydroxy-4-methyl-8-prop-2-enylchromene-2-thione.
| Compound Name | 6,7-dihydroxy-4-methyl-8-prop-2-enylchromene-2-thione |
|---|---|
| PubChem CID | 137292703 |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 6,7-dihydroxy-4-methyl-8-prop-2-enylchromene-2-thione |
| SMILES | C=CCc1c(O)c(O)cc2c(C)cc(=S)oc12 |
| InChI | InChI=1S/C13H12O3S/c1-3-4-8-12(15)10(14)6-9-7(2)5-11(17)16-13(8)9/h3,5-6,14-15H,1,4H2,2H3 |
| InChIKey | GYYYNXVMNRYGIU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|