C28H22O9 — CID 127051628
3,9-bis(3,4-dimethoxyphenyl)-5-hydroxypyrano[2,3-h]chromene-4,10-dione (PubChem CID 127051628) has the molecular formula C28H22O9 and a molecular weight of 502.48 g/mol. Its IUPAC name is 3,9-bis(3,4-dimethoxyphenyl)-5-hydroxypyrano[2,3-h]chromene-4,10-dione.
| Compound Name | 3,9-bis(3,4-dimethoxyphenyl)-5-hydroxypyrano[2,3-h]chromene-4,10-dione |
|---|---|
| PubChem CID | 127051628 |
| Molecular Formula | C28H22O9 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 3,9-bis(3,4-dimethoxyphenyl)-5-hydroxypyrano[2,3-h]chromene-4,10-dione |
| SMILES | COc1ccc(-c2coc3c(c(O)cc4occ(-c5ccc(OC)c(OC)c5)c(=O)c43)c2=O)cc1OC |
| InChI | InChI=1S/C28H22O9/c1-32-19-7-5-14(9-21(19)34-3)16-12-36-23-11-18(29)24-26(30)17(13-37-28(24)25(23)27(16)31)15-6-8-20(33-2)22(10-15)35-4/h5-13,29H,1-4H3 |
| InChIKey | HPVJWIGUQJWCAE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|