C23H24O9 — CID 163030491
5-hydroxy-7-methoxy-3-(4-methoxyphenyl)-8-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one (PubChem CID 163030491) has the molecular formula C23H24O9 and a molecular weight of 444.44 g/mol. Its IUPAC name is 5-hydroxy-7-methoxy-3-(4-methoxyphenyl)-8-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one.
| Compound Name | 5-hydroxy-7-methoxy-3-(4-methoxyphenyl)-8-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one |
|---|---|
| PubChem CID | 163030491 |
| Molecular Formula | C23H24O9 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 5-hydroxy-7-methoxy-3-(4-methoxyphenyl)-8-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]chromen-4-one |
| SMILES | COc1ccc(-c2coc3c([C@@H]4O[C@@H](C)[C@H](O)[C@H](O)[C@H]4O)c(OC)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C23H24O9/c1-10-18(25)20(27)21(28)23(32-10)17-15(30-3)8-14(24)16-19(26)13(9-31-22(16)17)11-4-6-12(29-2)7-5-11/h4-10,18,20-21,23-25,27-28H,1-3H3/t10-,18-,20-,21+,23-/m0/s1 |
| InChIKey | DXJQWYBXEGXWSW-HXDLVKGFSA-N |
| XLogP | 1.73 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |