C25H24O6 — CID 163030608
5-hydroxy-6-[(2R)-2-hydroxy-3-methylbut-3-enyl]-2-(4-hydroxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one (PubChem CID 163030608) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 5-hydroxy-6-[(2R)-2-hydroxy-3-methylbut-3-enyl]-2-(4-hydroxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one.
| Compound Name | 5-hydroxy-6-[(2R)-2-hydroxy-3-methylbut-3-enyl]-2-(4-hydroxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 163030608 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-hydroxy-6-[(2R)-2-hydroxy-3-methylbut-3-enyl]-2-(4-hydroxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one |
| SMILES | C=C(C)[C@H](O)Cc1c2c(c3oc(-c4ccc(O)cc4)cc(=O)c3c1O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C25H24O6/c1-13(2)18(27)11-17-22(29)21-19(28)12-20(14-5-7-15(26)8-6-14)30-24(21)16-9-10-25(3,4)31-23(16)17/h5-10,12,18,26-27,29H,1,11H2,2-4H3/t18-/m1/s1 |
| InChIKey | YDROLGFAZXVIJD-GOSISDBHSA-N |
| XLogP | 4.53 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|