C13H9NO3S — CID 5408024
7-hydroxy-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one (PubChem CID 5408024) has the molecular formula C13H9NO3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 7-hydroxy-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one.
| Compound Name | 7-hydroxy-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 5408024 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 7-hydroxy-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one |
| SMILES | Cc1nc(-c2coc3cc(O)ccc3c2=O)cs1 |
| InChI | InChI=1S/C13H9NO3S/c1-7-14-11(6-18-7)10-5-17-12-4-8(15)2-3-9(12)13(10)16/h2-6,15H,1H3 |
| InChIKey | GXXLJEJKWABOLT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |