C17H18N2O3S — CID 12869161
8-[(dimethylamino)methyl]-7-hydroxy-6-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one (PubChem CID 12869161) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 8-[(dimethylamino)methyl]-7-hydroxy-6-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one.
| Compound Name | 8-[(dimethylamino)methyl]-7-hydroxy-6-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 12869161 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 8-[(dimethylamino)methyl]-7-hydroxy-6-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one |
| SMILES | Cc1nc(-c2coc3c(CN(C)C)c(O)c(C)cc3c2=O)cs1 |
| InChI | InChI=1S/C17H18N2O3S/c1-9-5-11-16(21)13(14-8-23-10(2)18-14)7-22-17(11)12(15(9)20)6-19(3)4/h5,7-8,20H,6H2,1-4H3 |
| InChIKey | JJMYJHRFOGDCHS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|