C22H26N2O3S — CID 7372684
6-ethyl-7-hydroxy-8-[[(2R)-2-methylpiperidin-1-yl]methyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one (PubChem CID 7372684) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-8-[[(2R)-2-methylpiperidin-1-yl]methyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one.
| Compound Name | 6-ethyl-7-hydroxy-8-[[(2R)-2-methylpiperidin-1-yl]methyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one |
|---|---|
| PubChem CID | 7372684 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 6-ethyl-7-hydroxy-8-[[(2R)-2-methylpiperidin-1-yl]methyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one |
| SMILES | CCc1cc2c(=O)c(-c3nc(C)cs3)coc2c(CN2CCCC[C@H]2C)c1O |
| InChI | InChI=1S/C22H26N2O3S/c1-4-15-9-16-20(26)18(22-23-13(2)12-28-22)11-27-21(16)17(19(15)25)10-24-8-6-5-7-14(24)3/h9,11-12,14,25H,4-8,10H2,1-3H3/t14-/m1/s1 |
| InChIKey | FOSBHTHVGCKDJJ-CQSZACIVSA-N |
| XLogP | 4.87 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|