C26H27N3O3S — CID 42235480
6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[[(3S)-3-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one (PubChem CID 42235480) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[[(3S)-3-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one.
| Compound Name | 6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[[(3S)-3-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 42235480 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[[(3S)-3-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one |
| SMILES | CCc1cc2c(=O)c(-c3nc(C)cs3)coc2c(CN2CCC[C@@H](c3cccnc3)C2)c1O |
| InChI | InChI=1S/C26H27N3O3S/c1-3-17-10-20-24(31)22(26-28-16(2)15-33-26)14-32-25(20)21(23(17)30)13-29-9-5-7-19(12-29)18-6-4-8-27-11-18/h4,6,8,10-11,14-15,19,30H,3,5,7,9,12-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | MPNBYOPYBMAXEQ-LJQANCHMSA-N |
| XLogP | 5.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|