C19H23N2O3S+ — CID 6164699
diethyl-[[7-hydroxy-5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-8-yl]methyl]azanium (PubChem CID 6164699) has the molecular formula C19H23N2O3S+ and a molecular weight of 359.47 g/mol. Its IUPAC name is diethyl-[[7-hydroxy-5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-8-yl]methyl]azanium.
| Compound Name | diethyl-[[7-hydroxy-5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-8-yl]methyl]azanium |
|---|---|
| PubChem CID | 6164699 |
| Molecular Formula | C19H23N2O3S+ |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | diethyl-[[7-hydroxy-5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-8-yl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1c(O)cc(C)c2c(=O)c(-c3nc(C)cs3)coc12 |
| InChI | InChI=1S/C19H22N2O3S/c1-5-21(6-2)8-13-15(22)7-11(3)16-17(23)14(9-24-18(13)16)19-20-12(4)10-25-19/h7,9-10,22H,5-6,8H2,1-4H3/p+1 |
| InChIKey | LHAPAACVCGBGHB-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|