C28H30N2O4S — CID 42235484
6-ethyl-7-hydroxy-8-[(S)-(4-methoxyphenyl)-piperidin-1-ylmethyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one (PubChem CID 42235484) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-8-[(S)-(4-methoxyphenyl)-piperidin-1-ylmethyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one.
| Compound Name | 6-ethyl-7-hydroxy-8-[(S)-(4-methoxyphenyl)-piperidin-1-ylmethyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one |
|---|---|
| PubChem CID | 42235484 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 6-ethyl-7-hydroxy-8-[(S)-(4-methoxyphenyl)-piperidin-1-ylmethyl]-3-(4-methyl-1,3-thiazol-2-yl)chromen-4-one |
| SMILES | CCc1cc2c(=O)c(-c3nc(C)cs3)coc2c([C@H](c2ccc(OC)cc2)N2CCCCC2)c1O |
| InChI | InChI=1S/C28H30N2O4S/c1-4-18-14-21-26(32)22(28-29-17(2)16-35-28)15-34-27(21)23(25(18)31)24(30-12-6-5-7-13-30)19-8-10-20(33-3)11-9-19/h8-11,14-16,24,31H,4-7,12-13H2,1-3H3/t24-/m0/s1 |
| InChIKey | KCVHBNKQBLABRJ-DEOSSOPVSA-N |
| XLogP | 6.08 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|