C27H28N2O3S — CID 42235472
6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[(S)-phenyl(piperidin-1-yl)methyl]chromen-4-one (PubChem CID 42235472) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[(S)-phenyl(piperidin-1-yl)methyl]chromen-4-one.
| Compound Name | 6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[(S)-phenyl(piperidin-1-yl)methyl]chromen-4-one |
|---|---|
| PubChem CID | 42235472 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 6-ethyl-7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-8-[(S)-phenyl(piperidin-1-yl)methyl]chromen-4-one |
| SMILES | CCc1cc2c(=O)c(-c3nc(C)cs3)coc2c([C@H](c2ccccc2)N2CCCCC2)c1O |
| InChI | InChI=1S/C27H28N2O3S/c1-3-18-14-20-25(31)21(27-28-17(2)16-33-27)15-32-26(20)22(24(18)30)23(19-10-6-4-7-11-19)29-12-8-5-9-13-29/h4,6-7,10-11,14-16,23,30H,3,5,8-9,12-13H2,1-2H3/t23-/m0/s1 |
| InChIKey | VIUCQNIGRUFRKM-QHCPKHFHSA-N |
| XLogP | 6.07 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|