C22H20N2O3S — CID 134159715
8-[(benzylamino)methyl]-7-hydroxy-4-methyl-6-(2-methyl-1,3-thiazol-4-yl)chromen-2-one (PubChem CID 134159715) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 8-[(benzylamino)methyl]-7-hydroxy-4-methyl-6-(2-methyl-1,3-thiazol-4-yl)chromen-2-one.
| Compound Name | 8-[(benzylamino)methyl]-7-hydroxy-4-methyl-6-(2-methyl-1,3-thiazol-4-yl)chromen-2-one |
|---|---|
| PubChem CID | 134159715 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 8-[(benzylamino)methyl]-7-hydroxy-4-methyl-6-(2-methyl-1,3-thiazol-4-yl)chromen-2-one |
| SMILES | Cc1nc(-c2cc3c(C)cc(=O)oc3c(CNCc3ccccc3)c2O)cs1 |
| InChI | InChI=1S/C22H20N2O3S/c1-13-8-20(25)27-22-16(13)9-17(19-12-28-14(2)24-19)21(26)18(22)11-23-10-15-6-4-3-5-7-15/h3-9,12,23,26H,10-11H2,1-2H3 |
| InChIKey | GZOGHAKYZAFJBT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|