4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid

C15H11NO2S — CID 174668969

IUPAC4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid
SMILESCc1nc(-c2ccc(C(=O)O)c3ccccc23)cs1
InChIInChI=1S/C15H11NO2S/c1-9-16-14(8-19-9)12-6-7-13(15(17)18)11-5-3-2-4-10(11)12/h2-8H,1H3,(H,17,18)
InChIKeyZFVKOPFKKAEZFO-UHFFFAOYSA-N
MW269.33 g/mol
LogP3.97
Rot. Bonds2

About 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid

4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid (PubChem CID 174668969) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid.

Molecular Properties

Compound Name4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid
PubChem CID174668969
Molecular FormulaC15H11NO2S
Molecular Weight269.33 g/mol
Exact Mass269.05
IUPAC Name4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid
SMILESCc1nc(-c2ccc(C(=O)O)c3ccccc23)cs1
InChIInChI=1S/C15H11NO2S/c1-9-16-14(8-19-9)12-6-7-13(15(17)18)11-5-3-2-4-10(11)12/h2-8H,1H3,(H,17,18)
InChIKeyZFVKOPFKKAEZFO-UHFFFAOYSA-N
XLogP3.97
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.33
LogP ≤ 53.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid?
The IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid (CID 174668969) is 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid.
What is the SMILES notation for 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid?
The canonical SMILES for 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid is Cc1nc(-c2ccc(C(=O)O)c3ccccc23)cs1.
What is the InChIKey of 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid?
The InChIKey is ZFVKOPFKKAEZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2S/c1-9-16-14(8-19-9)12-6-7-13(15(17)18)11-5-3-2-4-10(11)12/h2-8H,1H3,(H,17,18).
What are the key properties of 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid?
4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid has a molecular weight of 269.33 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid is sourced from PubChem (CID 174668969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).