C15H11NO2S — CID 174668969
4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid (PubChem CID 174668969) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid.
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 174668969 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)naphthalene-1-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(C(=O)O)c3ccccc23)cs1 |
| InChI | InChI=1S/C15H11NO2S/c1-9-16-14(8-19-9)12-6-7-13(15(17)18)11-5-3-2-4-10(11)12/h2-8H,1H3,(H,17,18) |
| InChIKey | ZFVKOPFKKAEZFO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |