C28H23N3O3S — CID 24509005
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-3-phenylpropanamide (PubChem CID 24509005) has the molecular formula C28H23N3O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 24509005 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-3-phenylpropanamide |
| SMILES | Cc1nc(-c2ccc(CNC(=O)[C@H](Cc3ccccc3)N3C(=O)c4ccccc4C3=O)cc2)cs1 |
| InChI | InChI=1S/C28H23N3O3S/c1-18-30-24(17-35-18)21-13-11-20(12-14-21)16-29-26(32)25(15-19-7-3-2-4-8-19)31-27(33)22-9-5-6-10-23(22)28(31)34/h2-14,17,25H,15-16H2,1H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | GWHJLAUPSGGTBF-VWLOTQADSA-N |
| XLogP | 4.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|