C30H25N3O3S — CID 2487274
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]propanamide (PubChem CID 2487274) has the molecular formula C30H25N3O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 2487274 |
| Molecular Formula | C30H25N3O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)CCCC3)cs1)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H25N3O3S/c34-27(32-30-31-25(18-37-30)22-15-14-20-10-4-5-11-21(20)17-22)26(16-19-8-2-1-3-9-19)33-28(35)23-12-6-7-13-24(23)29(33)36/h1-3,6-9,12-15,17-18,26H,4-5,10-11,16H2,(H,31,32,34)/t26-/m1/s1 |
| InChIKey | FPTKCKGVCNCNQS-AREMUKBSSA-N |
| XLogP | 5.53 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|