C27H19N3O5S — CID 55943248
(2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 55943248) has the molecular formula C27H19N3O5S and a molecular weight of 497.53 g/mol. Its IUPAC name is (2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | (2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 55943248 |
| Molecular Formula | C27H19N3O5S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | (2S)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)OCO3)cs1)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H19N3O5S/c31-24(29-27-28-20(14-36-27)17-10-11-22-23(13-17)35-15-34-22)21(12-16-6-2-1-3-7-16)30-25(32)18-8-4-5-9-19(18)26(30)33/h1-11,13-14,21H,12,15H2,(H,28,29,31)/t21-/m0/s1 |
| InChIKey | UTJXAGIHOKWUHD-NRFANRHFSA-N |
| XLogP | 4.38 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|