C22H19N3O3S — CID 108760210
2-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenylpropanamide (PubChem CID 108760210) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenylpropanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 108760210 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenylpropanamide |
| SMILES | Cc1nc(CNC(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)cs1 |
| InChI | InChI=1S/C22H19N3O3S/c1-14-24-16(13-29-14)12-23-20(26)19(11-15-7-3-2-4-8-15)25-21(27)17-9-5-6-10-18(17)22(25)28/h2-10,13,19H,11-12H2,1H3,(H,23,26) |
| InChIKey | GBFGEQSQZAEVQS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|